C26H36O7 — CID 158858996
2-butyl-2-methoxy-1,3-diphenylpropane-1,3-dione;3-(2-hydroxypropoxy)propane-1,2-diol (PubChem CID 158858996) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is 2-butyl-2-methoxy-1,3-diphenylpropane-1,3-dione;3-(2-hydroxypropoxy)propane-1,2-diol.
| Compound Name | 2-butyl-2-methoxy-1,3-diphenylpropane-1,3-dione;3-(2-hydroxypropoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 158858996 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 2-butyl-2-methoxy-1,3-diphenylpropane-1,3-dione;3-(2-hydroxypropoxy)propane-1,2-diol |
| SMILES | CC(O)COCC(O)CO.CCCCC(OC)(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22O3.C6H14O4/c1-3-4-15-20(23-2,18(21)16-11-7-5-8-12-16)19(22)17-13-9-6-10-14-17;1-5(8)3-10-4-6(9)2-7/h5-14H,3-4,15H2,1-2H3;5-9H,2-4H2,1H3 |
| InChIKey | JAKMSWZSPCDVMP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|