C38H70N2O5Si2 — CID 158860959
CID 158860959 (PubChem CID 158860959) has the molecular formula C38H70N2O5Si2 and a molecular weight of 697.18 g/mol.
| Compound Name | CID 158860959 |
|---|---|
| PubChem CID | 158860959 |
| Molecular Formula | C38H70N2O5Si2 |
| Molecular Weight | 697.18 g/mol |
| Exact Mass | 696.51 |
| IUPAC Name | — |
| SMILES | CCC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)CCCOC#N)CC[C@]4(C)[C@H]3C[C@H](O[Si](C)(C)CCCOC#N)[C@]12C.[3H][3H].[H][3H] |
| InChI | InChI=1S/C38H66N2O5Si2.2H2/c1-9-30(41)14-12-28(2)33-16-17-34-32-15-13-29-24-31(44-46(5,6)22-10-20-42-26-39)18-19-37(29,3)35(32)25-36(38(33,34)4)45-47(7,8)23-11-21-43-27-40;;/h28-29,31-36H,9-25H2,1-8H3;2*1H/t28-,29-,31-,32+,33-,34+,35+,36+,37+,38-;;/m1../s1/i;1+2T;1+2 |
| InChIKey | JAQLAFDXTMYJHP-UJOOXBDESA-N |
| XLogP | 10.10 |
| TPSA | 101.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.18 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|