C15H40N6S3 — CID 158867381
2-(3-aminopropylamino)ethanethiol;N'-[2-[2-(3-aminopropylamino)ethylsulfinothioyl]ethyl]propane-1,3-diamine (PubChem CID 158867381) has the molecular formula C15H40N6S3 and a molecular weight of 400.73 g/mol. Its IUPAC name is 2-(3-aminopropylamino)ethanethiol;N'-[2-[2-(3-aminopropylamino)ethylsulfinothioyl]ethyl]propane-1,3-diamine.
| Compound Name | 2-(3-aminopropylamino)ethanethiol;N'-[2-[2-(3-aminopropylamino)ethylsulfinothioyl]ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 158867381 |
| Molecular Formula | C15H40N6S3 |
| Molecular Weight | 400.73 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 2-(3-aminopropylamino)ethanethiol;N'-[2-[2-(3-aminopropylamino)ethylsulfinothioyl]ethyl]propane-1,3-diamine |
| SMILES | NCCCNCCS.NCCCNCCS(=S)CCNCCCN |
| InChI | InChI=1S/C10H26N4S2.C5H14N2S/c11-3-1-5-13-7-9-16(15)10-8-14-6-2-4-12;6-2-1-3-7-4-5-8/h13-14H,1-12H2;7-8H,1-6H2 |
| InChIKey | JBKIJJQOWNENRZ-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.73 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|