C24H29Cl2N3O — CID 158869224
(3R)-1-[2-[(2,6-dichlorophenyl)methyl]-3-methylimidazo[4,5-b]pyridin-6-yl]-3-methylnonan-1-one (PubChem CID 158869224) has the molecular formula C24H29Cl2N3O and a molecular weight of 446.42 g/mol. Its IUPAC name is (3R)-1-[2-[(2,6-dichlorophenyl)methyl]-3-methylimidazo[4,5-b]pyridin-6-yl]-3-methylnonan-1-one.
| Compound Name | (3R)-1-[2-[(2,6-dichlorophenyl)methyl]-3-methylimidazo[4,5-b]pyridin-6-yl]-3-methylnonan-1-one |
|---|---|
| PubChem CID | 158869224 |
| Molecular Formula | C24H29Cl2N3O |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (3R)-1-[2-[(2,6-dichlorophenyl)methyl]-3-methylimidazo[4,5-b]pyridin-6-yl]-3-methylnonan-1-one |
| SMILES | CCCCCC[C@@H](C)CC(=O)c1cnc2c(c1)nc(Cc1c(Cl)cccc1Cl)n2C |
| InChI | InChI=1S/C24H29Cl2N3O/c1-4-5-6-7-9-16(2)12-22(30)17-13-21-24(27-15-17)29(3)23(28-21)14-18-19(25)10-8-11-20(18)26/h8,10-11,13,15-16H,4-7,9,12,14H2,1-3H3/t16-/m1/s1 |
| InChIKey | JBQAZHWUJWNREH-MRXNPFEDSA-N |
| XLogP | 7.05 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|