C23H27Cl2N3O — CID 159187628
(3S)-1-[2-[(2,6-dichlorophenyl)methyl]-3-methylimidazo[4,5-b]pyridin-6-yl]-3-methyloctan-1-one (PubChem CID 159187628) has the molecular formula C23H27Cl2N3O and a molecular weight of 432.40 g/mol. Its IUPAC name is (3S)-1-[2-[(2,6-dichlorophenyl)methyl]-3-methylimidazo[4,5-b]pyridin-6-yl]-3-methyloctan-1-one.
| Compound Name | (3S)-1-[2-[(2,6-dichlorophenyl)methyl]-3-methylimidazo[4,5-b]pyridin-6-yl]-3-methyloctan-1-one |
|---|---|
| PubChem CID | 159187628 |
| Molecular Formula | C23H27Cl2N3O |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (3S)-1-[2-[(2,6-dichlorophenyl)methyl]-3-methylimidazo[4,5-b]pyridin-6-yl]-3-methyloctan-1-one |
| SMILES | CCCCC[C@H](C)CC(=O)c1cnc2c(c1)nc(Cc1c(Cl)cccc1Cl)n2C |
| InChI | InChI=1S/C23H27Cl2N3O/c1-4-5-6-8-15(2)11-21(29)16-12-20-23(26-14-16)28(3)22(27-20)13-17-18(24)9-7-10-19(17)25/h7,9-10,12,14-15H,4-6,8,11,13H2,1-3H3/t15-/m0/s1 |
| InChIKey | KNROVYYEIBWMAW-HNNXBMFYSA-N |
| XLogP | 6.66 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|