C29H38ClN5O3S — CID 158870377
N-[2-[4-[(2R)-3-(4-chlorophenyl)-2-[[4-(dimethylamino)phenyl]methylamino]propanoyl]piperazin-1-yl]phenyl]methanesulfonamide;molecular hydrogen (PubChem CID 158870377) has the molecular formula C29H38ClN5O3S and a molecular weight of 572.18 g/mol. Its IUPAC name is N-[2-[4-[(2R)-3-(4-chlorophenyl)-2-[[4-(dimethylamino)phenyl]methylamino]propanoyl]piperazin-1-yl]phenyl]methanesulfonamide;molecular hydrogen.
| Compound Name | N-[2-[4-[(2R)-3-(4-chlorophenyl)-2-[[4-(dimethylamino)phenyl]methylamino]propanoyl]piperazin-1-yl]phenyl]methanesulfonamide;molecular hydrogen |
|---|---|
| PubChem CID | 158870377 |
| Molecular Formula | C29H38ClN5O3S |
| Molecular Weight | 572.18 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | N-[2-[4-[(2R)-3-(4-chlorophenyl)-2-[[4-(dimethylamino)phenyl]methylamino]propanoyl]piperazin-1-yl]phenyl]methanesulfonamide;molecular hydrogen |
| SMILES | CN(C)c1ccc(CN[C@H](Cc2ccc(Cl)cc2)C(=O)N2CCN(c3ccccc3NS(C)(=O)=O)CC2)cc1.[H][H] |
| InChI | InChI=1S/C29H36ClN5O3S.H2/c1-33(2)25-14-10-23(11-15-25)21-31-27(20-22-8-12-24(30)13-9-22)29(36)35-18-16-34(17-19-35)28-7-5-4-6-26(28)32-39(3,37)38;/h4-15,27,31-32H,16-21H2,1-3H3;1H/t27-;/m1./s1 |
| InChIKey | JBTNBSMVYXNHMR-HZPIKELBSA-N |
| XLogP | 4.07 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.18 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|