C20H27ClN4O2S — CID 69076640
N-[2-[4-[(2R)-2-amino-3-(4-chlorophenyl)propyl]piperazin-1-yl]phenyl]methanesulfonamide (PubChem CID 69076640) has the molecular formula C20H27ClN4O2S and a molecular weight of 422.98 g/mol. Its IUPAC name is N-[2-[4-[(2R)-2-amino-3-(4-chlorophenyl)propyl]piperazin-1-yl]phenyl]methanesulfonamide.
| Compound Name | N-[2-[4-[(2R)-2-amino-3-(4-chlorophenyl)propyl]piperazin-1-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 69076640 |
| Molecular Formula | C20H27ClN4O2S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-[2-[4-[(2R)-2-amino-3-(4-chlorophenyl)propyl]piperazin-1-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1N1CCN(C[C@H](N)Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H27ClN4O2S/c1-28(26,27)23-19-4-2-3-5-20(19)25-12-10-24(11-13-25)15-18(22)14-16-6-8-17(21)9-7-16/h2-9,18,23H,10-15,22H2,1H3/t18-/m1/s1 |
| InChIKey | ALJALAPVESYWLS-GOSISDBHSA-N |
| XLogP | 2.40 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |