C25H40O9 — CID 158872696
dicyclohexyl (Z)-but-2-enedioate;2-(ethoxymethyl)-2-propylpropanedioic acid (PubChem CID 158872696) has the molecular formula C25H40O9 and a molecular weight of 484.59 g/mol. Its IUPAC name is dicyclohexyl (Z)-but-2-enedioate;2-(ethoxymethyl)-2-propylpropanedioic acid.
| Compound Name | dicyclohexyl (Z)-but-2-enedioate;2-(ethoxymethyl)-2-propylpropanedioic acid |
|---|---|
| PubChem CID | 158872696 |
| Molecular Formula | C25H40O9 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | dicyclohexyl (Z)-but-2-enedioate;2-(ethoxymethyl)-2-propylpropanedioic acid |
| SMILES | CCCC(COCC)(C(=O)O)C(=O)O.O=C(/C=C\C(=O)OC1CCCCC1)OC1CCCCC1 |
| InChI | InChI=1S/C16H24O4.C9H16O5/c17-15(19-13-7-3-1-4-8-13)11-12-16(18)20-14-9-5-2-6-10-14;1-3-5-9(7(10)11,8(12)13)6-14-4-2/h11-14H,1-10H2;3-6H2,1-2H3,(H,10,11)(H,12,13)/b12-11-; |
| InChIKey | JCATVTBNGSOMKW-AFEZEDKISA-N |
| XLogP | 4.27 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|