C24H38O8 — CID 158230195
dicyclohexyl (Z)-but-2-enedioate;2-(3-methylbutyl)propanedioic acid (PubChem CID 158230195) has the molecular formula C24H38O8 and a molecular weight of 454.56 g/mol. Its IUPAC name is dicyclohexyl (Z)-but-2-enedioate;2-(3-methylbutyl)propanedioic acid.
| Compound Name | dicyclohexyl (Z)-but-2-enedioate;2-(3-methylbutyl)propanedioic acid |
|---|---|
| PubChem CID | 158230195 |
| Molecular Formula | C24H38O8 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | dicyclohexyl (Z)-but-2-enedioate;2-(3-methylbutyl)propanedioic acid |
| SMILES | CC(C)CCC(C(=O)O)C(=O)O.O=C(/C=C\C(=O)OC1CCCCC1)OC1CCCCC1 |
| InChI | InChI=1S/C16H24O4.C8H14O4/c17-15(19-13-7-3-1-4-8-13)11-12-16(18)20-14-9-5-2-6-10-14;1-5(2)3-4-6(7(9)10)8(11)12/h11-14H,1-10H2;5-6H,3-4H2,1-2H3,(H,9,10)(H,11,12)/b12-11-; |
| InChIKey | GEHBQUREPNGCDW-AFEZEDKISA-N |
| XLogP | 4.50 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|