C16H24O6 — CID 162734039
3-[(E)-4-cyclooctyloxy-4-oxobut-2-enoyl]oxybutanoic acid (PubChem CID 162734039) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is 3-[(E)-4-cyclooctyloxy-4-oxobut-2-enoyl]oxybutanoic acid.
| Compound Name | 3-[(E)-4-cyclooctyloxy-4-oxobut-2-enoyl]oxybutanoic acid |
|---|---|
| PubChem CID | 162734039 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-[(E)-4-cyclooctyloxy-4-oxobut-2-enoyl]oxybutanoic acid |
| SMILES | CC(CC(=O)O)OC(=O)/C=C/C(=O)OC1CCCCCCC1 |
| InChI | InChI=1S/C16H24O6/c1-12(11-14(17)18)21-15(19)9-10-16(20)22-13-7-5-3-2-4-6-8-13/h9-10,12-13H,2-8,11H2,1H3,(H,17,18)/b10-9+ |
| InChIKey | LSGHLNJRRVXLSV-MDZDMXLPSA-N |
| XLogP | 2.61 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|