C29H27N5O3S — CID 158876248
N-[5-[[4-(3H-inden-1-yl)thieno[3,2-d]pyrimidin-2-yl]amino]-4-methoxy-2-morpholin-4-ylphenyl]prop-2-enamide (PubChem CID 158876248) has the molecular formula C29H27N5O3S and a molecular weight of 525.63 g/mol. Its IUPAC name is N-[5-[[4-(3H-inden-1-yl)thieno[3,2-d]pyrimidin-2-yl]amino]-4-methoxy-2-morpholin-4-ylphenyl]prop-2-enamide.
| Compound Name | N-[5-[[4-(3H-inden-1-yl)thieno[3,2-d]pyrimidin-2-yl]amino]-4-methoxy-2-morpholin-4-ylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 158876248 |
| Molecular Formula | C29H27N5O3S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | N-[5-[[4-(3H-inden-1-yl)thieno[3,2-d]pyrimidin-2-yl]amino]-4-methoxy-2-morpholin-4-ylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nc(C3=CCc4ccccc43)c3sccc3n2)c(OC)cc1N1CCOCC1 |
| InChI | InChI=1S/C29H27N5O3S/c1-3-26(35)30-22-16-23(25(36-2)17-24(22)34-11-13-37-14-12-34)32-29-31-21-10-15-38-28(21)27(33-29)20-9-8-18-6-4-5-7-19(18)20/h3-7,9-10,15-17H,1,8,11-14H2,2H3,(H,30,35)(H,31,32,33) |
| InChIKey | JCLUPZIBNWVJHY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|