C30H27B7N8O4 — CID 174030470
CID 174030470 (PubChem CID 174030470) has the molecular formula C30H27B7N8O4 and a molecular weight of 639.28 g/mol.
| Compound Name | CID 174030470 |
|---|---|
| PubChem CID | 174030470 |
| Molecular Formula | C30H27B7N8O4 |
| Molecular Weight | 639.28 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c(-c2nn(-c3ccnc(Nc4cc(NC(=O)C=C)c(N5CCOCC5)cc4OC)n3)c([B])c2C([B])([B])N(C)C)c([B])c([B])c1O |
| InChI | InChI=1S/C30H27B7N8O4/c1-5-19(46)39-14-12-15(17(48-4)13-16(14)44-8-10-49-11-9-44)40-29-38-7-6-18(41-29)45-28(35)21(30(36,37)43(2)3)26(42-45)20-22(31)24(33)27(47)25(34)23(20)32/h5-7,12-13,47H,1,8-11H2,2-4H3,(H,39,46)(H,38,40,41) |
| InChIKey | MOLKIOOAYKSWHX-UHFFFAOYSA-N |
| XLogP | -3.27 |
| TPSA | 129.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.28 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|