About dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium)
dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium) (PubChem CID 158880837) has the molecular formula C10H25NO3SY6
and a molecular weight of 772.82 g/mol. Its IUPAC name is dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium).
Molecular Properties
| Compound Name | dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium) |
| PubChem CID | 158880837 |
| Molecular Formula | C10H25NO3SY6 |
| Molecular Weight | 772.82 g/mol |
| Exact Mass | 772.59 |
| IUPAC Name | dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium) |
| SMILES | CCCCCS(=O)(=O)[O-].CCC[NH+](C)C.[Y].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C5H13N.C5H12O3S.6Y/c1-4-5-6(2)3;1-2-3-4-5-9(6,7)8;;;;;;/h4-5H2,1-3H3;2-5H2,1H3,(H,6,7,8);;;;;; |
| InChIKey | JCZXQTBLDPXUEY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 772.82 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium)?
The IUPAC name of dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium) (CID 158880837) is dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium).
What is the SMILES notation for dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium)?
The canonical SMILES for dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium) is CCCCCS(=O)(=O)[O-].CCC[NH+](C)C.[Y].[Y].[Y].[Y].[Y].[Y].
What is the InChIKey of dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium)?
The InChIKey is JCZXQTBLDPXUEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N.C5H12O3S.6Y/c1-4-5-6(2)3;1-2-3-4-5-9(6,7)8;;;;;;/h4-5H2,1-3H3;2-5H2,1H3,(H,6,7,8);;;;;;.
What are the key properties of dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium)?
dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium) has a molecular weight of 772.82 g/mol, XLogP of 0.25, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(propyl)azanium;pentane-1-sulfonate;hexakis(yttrium) is sourced from PubChem (CID 158880837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).