C66H46B2N2O6S3 — CID 158891677
5-[4-(benzenesulfonyl)phenyl]-10-phenylbenzo[b][1,4]benzazaborinine;2-[4-(10-phenylbenzo[b][1,4]benzazaborinin-5-yl)phenyl]thianthrene 5,5,10,10-tetraoxide (PubChem CID 158891677) has the molecular formula C66H46B2N2O6S3 and a molecular weight of 1080.93 g/mol. Its IUPAC name is 5-[4-(benzenesulfonyl)phenyl]-10-phenylbenzo[b][1,4]benzazaborinine;2-[4-(10-phenylbenzo[b][1,4]benzazaborinin-5-yl)phenyl]thianthrene 5,5,10,10-tetraoxide.
| Compound Name | 5-[4-(benzenesulfonyl)phenyl]-10-phenylbenzo[b][1,4]benzazaborinine;2-[4-(10-phenylbenzo[b][1,4]benzazaborinin-5-yl)phenyl]thianthrene 5,5,10,10-tetraoxide |
|---|---|
| PubChem CID | 158891677 |
| Molecular Formula | C66H46B2N2O6S3 |
| Molecular Weight | 1080.93 g/mol |
| Exact Mass | 1080.27 |
| IUPAC Name | 5-[4-(benzenesulfonyl)phenyl]-10-phenylbenzo[b][1,4]benzazaborinine;2-[4-(10-phenylbenzo[b][1,4]benzazaborinin-5-yl)phenyl]thianthrene 5,5,10,10-tetraoxide |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(N2c3ccccc3B(c3ccccc3)c3ccccc32)cc1.O=S1(=O)c2ccccc2S(=O)(=O)c2cc(-c3ccc(N4c5ccccc5B(c5ccccc5)c5ccccc54)cc3)ccc21 |
| InChI | InChI=1S/C36H24BNO4S2.C30H22BNO2S/c39-43(40)33-16-8-9-17-34(33)44(41,42)36-24-26(20-23-35(36)43)25-18-21-28(22-19-25)38-31-14-6-4-12-29(31)37(27-10-2-1-3-11-27)30-13-5-7-15-32(30)38;33-35(34,25-13-5-2-6-14-25)26-21-19-24(20-22-26)32-29-17-9-7-15-27(29)31(23-11-3-1-4-12-23)28-16-8-10-18-30(28)32/h1-24H;1-22H |
| InChIKey | JEHVPIWSVUFFHV-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1080.93 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|