C20H37N3O3 — CID 158892759
1-[5-[[(1R,2R)-1,3-dihydroxy-1-(4-methylphenyl)propan-2-yl]amino]pentyl]-3-methylurea;propane (PubChem CID 158892759) has the molecular formula C20H37N3O3 and a molecular weight of 367.53 g/mol. Its IUPAC name is 1-[5-[[(1R,2R)-1,3-dihydroxy-1-(4-methylphenyl)propan-2-yl]amino]pentyl]-3-methylurea;propane.
| Compound Name | 1-[5-[[(1R,2R)-1,3-dihydroxy-1-(4-methylphenyl)propan-2-yl]amino]pentyl]-3-methylurea;propane |
|---|---|
| PubChem CID | 158892759 |
| Molecular Formula | C20H37N3O3 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.28 |
| IUPAC Name | 1-[5-[[(1R,2R)-1,3-dihydroxy-1-(4-methylphenyl)propan-2-yl]amino]pentyl]-3-methylurea;propane |
| SMILES | CCC.CNC(=O)NCCCCCN[C@H](CO)[C@H](O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H29N3O3.C3H8/c1-13-6-8-14(9-7-13)16(22)15(12-21)19-10-4-3-5-11-20-17(23)18-2;1-3-2/h6-9,15-16,19,21-22H,3-5,10-12H2,1-2H3,(H2,18,20,23);3H2,1-2H3/t15-,16-;/m1./s1 |
| InChIKey | JELFOLTWOASAPK-QNBGGDODSA-N |
| XLogP | 2.49 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|