C33H26BN4- — CID 158893462
boranuide;9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole (PubChem CID 158893462) has the molecular formula C33H26BN4- and a molecular weight of 489.41 g/mol. Its IUPAC name is boranuide;9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole.
| Compound Name | boranuide;9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 158893462 |
| Molecular Formula | C33H26BN4- |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | boranuide;9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
| SMILES | [BH4-].c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3-n3c4ccccc4c4ccccc43)n2)cc1 |
| InChI | InChI=1S/C33H22N4.BH4/c1-3-13-23(14-4-1)31-34-32(24-15-5-2-6-16-24)36-33(35-31)27-19-9-12-22-30(27)37-28-20-10-7-17-25(28)26-18-8-11-21-29(26)37;/h1-22H;1H4/q;-1 |
| InChIKey | JENMMWBREIRDAB-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|