C34H35NOS — CID 158894044
10-but-3-ynylphenothiazine;ethane;2-propan-2-yl-6-prop-2-ynoxynaphthalene (PubChem CID 158894044) has the molecular formula C34H35NOS and a molecular weight of 505.73 g/mol. Its IUPAC name is 10-but-3-ynylphenothiazine;ethane;2-propan-2-yl-6-prop-2-ynoxynaphthalene.
| Compound Name | 10-but-3-ynylphenothiazine;ethane;2-propan-2-yl-6-prop-2-ynoxynaphthalene |
|---|---|
| PubChem CID | 158894044 |
| Molecular Formula | C34H35NOS |
| Molecular Weight | 505.73 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 10-but-3-ynylphenothiazine;ethane;2-propan-2-yl-6-prop-2-ynoxynaphthalene |
| SMILES | C#CCCN1c2ccccc2Sc2ccccc21.C#CCOc1ccc2cc(C(C)C)ccc2c1.CC |
| InChI | InChI=1S/C16H13NS.C16H16O.C2H6/c1-2-3-12-17-13-8-4-6-10-15(13)18-16-11-7-5-9-14(16)17;1-4-9-17-16-8-7-14-10-13(12(2)3)5-6-15(14)11-16;1-2/h1,4-11H,3,12H2;1,5-8,10-12H,9H2,2-3H3;1-2H3 |
| InChIKey | JEPLELAZQNRQON-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.73 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|