C26H25N5O2 — CID 158896639
3-methyl-N-phenyl-6-[4-(4-prop-2-ynylpiperazine-1-carbonyl)phenyl]pyrazine-2-carboxamide (PubChem CID 158896639) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-methyl-N-phenyl-6-[4-(4-prop-2-ynylpiperazine-1-carbonyl)phenyl]pyrazine-2-carboxamide.
| Compound Name | 3-methyl-N-phenyl-6-[4-(4-prop-2-ynylpiperazine-1-carbonyl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 158896639 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 3-methyl-N-phenyl-6-[4-(4-prop-2-ynylpiperazine-1-carbonyl)phenyl]pyrazine-2-carboxamide |
| SMILES | C#CCN1CCN(C(=O)c2ccc(-c3cnc(C)c(C(=O)Nc4ccccc4)n3)cc2)CC1 |
| InChI | InChI=1S/C26H25N5O2/c1-3-13-30-14-16-31(17-15-30)26(33)21-11-9-20(10-12-21)23-18-27-19(2)24(29-23)25(32)28-22-7-5-4-6-8-22/h1,4-12,18H,13-17H2,2H3,(H,28,32) |
| InChIKey | QWJQACJVJPUDOE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|