C23H24N6O2 — CID 59471661
3-amino-6-[3-(4-methylpiperazine-1-carbonyl)phenyl]-N-phenylpyrazine-2-carboxamide (PubChem CID 59471661) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 3-amino-6-[3-(4-methylpiperazine-1-carbonyl)phenyl]-N-phenylpyrazine-2-carboxamide.
| Compound Name | 3-amino-6-[3-(4-methylpiperazine-1-carbonyl)phenyl]-N-phenylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59471661 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 3-amino-6-[3-(4-methylpiperazine-1-carbonyl)phenyl]-N-phenylpyrazine-2-carboxamide |
| SMILES | CN1CCN(C(=O)c2cccc(-c3cnc(N)c(C(=O)Nc4ccccc4)n3)c2)CC1 |
| InChI | InChI=1S/C23H24N6O2/c1-28-10-12-29(13-11-28)23(31)17-7-5-6-16(14-17)19-15-25-21(24)20(27-19)22(30)26-18-8-3-2-4-9-18/h2-9,14-15H,10-13H2,1H3,(H2,24,25)(H,26,30) |
| InChIKey | MNPFHKHDEHVUED-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |