fluoroform;methanesulfonyl chloride

C2H4ClF3O2S — CID 158897545

IUPACfluoroform;methanesulfonyl chloride
SMILESCS(=O)(=O)Cl.FC(F)F
InChIInChI=1S/CH3ClO2S.CHF3/c1-5(2,3)4;2-1(3)4/h1H3;1H
InChIKeyJFAFIPYQXOLZEU-UHFFFAOYSA-N
MW184.57 g/mol
LogP1.36
Rot. Bonds

About fluoroform;methanesulfonyl chloride

fluoroform;methanesulfonyl chloride (PubChem CID 158897545) has the molecular formula C2H4ClF3O2S and a molecular weight of 184.57 g/mol. Its IUPAC name is fluoroform;methanesulfonyl chloride.

Molecular Properties

Compound Namefluoroform;methanesulfonyl chloride
PubChem CID158897545
Molecular FormulaC2H4ClF3O2S
Molecular Weight184.57 g/mol
Exact Mass183.96
IUPAC Namefluoroform;methanesulfonyl chloride
SMILESCS(=O)(=O)Cl.FC(F)F
InChIInChI=1S/CH3ClO2S.CHF3/c1-5(2,3)4;2-1(3)4/h1H3;1H
InChIKeyJFAFIPYQXOLZEU-UHFFFAOYSA-N
XLogP1.36
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.57
LogP ≤ 51.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze fluoroform;methanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of fluoroform;methanesulfonyl chloride?
The IUPAC name of fluoroform;methanesulfonyl chloride (CID 158897545) is fluoroform;methanesulfonyl chloride.
What is the SMILES notation for fluoroform;methanesulfonyl chloride?
The canonical SMILES for fluoroform;methanesulfonyl chloride is CS(=O)(=O)Cl.FC(F)F.
What is the InChIKey of fluoroform;methanesulfonyl chloride?
The InChIKey is JFAFIPYQXOLZEU-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3ClO2S.CHF3/c1-5(2,3)4;2-1(3)4/h1H3;1H.
What are the key properties of fluoroform;methanesulfonyl chloride?
fluoroform;methanesulfonyl chloride has a molecular weight of 184.57 g/mol, XLogP of 1.36, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;methanesulfonyl chloride is sourced from PubChem (CID 158897545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).