C27H26N10O6 — CID 158899197
tert-butyl 4-(1-methyl-5-nitroindazol-3-yl)pyrazole-1-carboxylate;1-methyl-5-nitro-3-(1H-pyrazol-4-yl)indazole (PubChem CID 158899197) has the molecular formula C27H26N10O6 and a molecular weight of 586.57 g/mol. Its IUPAC name is tert-butyl 4-(1-methyl-5-nitroindazol-3-yl)pyrazole-1-carboxylate;1-methyl-5-nitro-3-(1H-pyrazol-4-yl)indazole.
| Compound Name | tert-butyl 4-(1-methyl-5-nitroindazol-3-yl)pyrazole-1-carboxylate;1-methyl-5-nitro-3-(1H-pyrazol-4-yl)indazole |
|---|---|
| PubChem CID | 158899197 |
| Molecular Formula | C27H26N10O6 |
| Molecular Weight | 586.57 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | tert-butyl 4-(1-methyl-5-nitroindazol-3-yl)pyrazole-1-carboxylate;1-methyl-5-nitro-3-(1H-pyrazol-4-yl)indazole |
| SMILES | Cn1nc(-c2cn[nH]c2)c2cc([N+](=O)[O-])ccc21.Cn1nc(-c2cnn(C(=O)OC(C)(C)C)c2)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H17N5O4.C11H9N5O2/c1-16(2,3)25-15(22)20-9-10(8-17-20)14-12-7-11(21(23)24)5-6-13(12)19(4)18-14;1-15-10-3-2-8(16(17)18)4-9(10)11(14-15)7-5-12-13-6-7/h5-9H,1-4H3;2-6H,1H3,(H,12,13) |
| InChIKey | JFFGVYCBTFYDRL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 194.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|