About (2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane
(2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane (PubChem CID 158900562) has the molecular formula C33H62
and a molecular weight of 458.86 g/mol. Its IUPAC name is (2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane.
Molecular Properties
| Compound Name | (2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane |
| PubChem CID | 158900562 |
| Molecular Formula | C33H62 |
| Molecular Weight | 458.86 g/mol |
| Exact Mass | 458.49 |
| IUPAC Name | (2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane |
| SMILES | CC1CCCCCCCCC1.CCCCCC1CCC(C2CCCCC2)C1C1CCCCC1 |
| InChI | InChI=1S/C22H40.C11H22/c1-2-3-6-13-20-16-17-21(18-11-7-4-8-12-18)22(20)19-14-9-5-10-15-19;1-11-9-7-5-3-2-4-6-8-10-11/h18-22H,2-17H2,1H3;11H,2-10H2,1H3 |
| InChIKey | JFJULPJTFAYQRY-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.86 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane?
The IUPAC name of (2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane (CID 158900562) is (2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane.
What is the SMILES notation for (2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane?
The canonical SMILES for (2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane is CC1CCCCCCCCC1.CCCCCC1CCC(C2CCCCC2)C1C1CCCCC1.
What is the InChIKey of (2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane?
The InChIKey is JFJULPJTFAYQRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40.C11H22/c1-2-3-6-13-20-16-17-21(18-11-7-4-8-12-18)22(20)19-14-9-5-10-15-19;1-11-9-7-5-3-2-4-6-8-10-11/h18-22H,2-17H2,1H3;11H,2-10H2,1H3.
What are the key properties of (2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane?
(2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane has a molecular weight of 458.86 g/mol, XLogP of 11.52, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclohexyl-3-pentylcyclopentyl)cyclohexane;methylcyclodecane is sourced from PubChem (CID 158900562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).