C37H46N6O2 — CID 158901765
5-methyl-5-(methylamino)-1-[4-[[13-[4-methyl-4-(methylamino)pentanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl]methyl]phenyl]hexan-1-one (PubChem CID 158901765) has the molecular formula C37H46N6O2 and a molecular weight of 606.82 g/mol. Its IUPAC name is 5-methyl-5-(methylamino)-1-[4-[[13-[4-methyl-4-(methylamino)pentanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl]methyl]phenyl]hexan-1-one.
| Compound Name | 5-methyl-5-(methylamino)-1-[4-[[13-[4-methyl-4-(methylamino)pentanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl]methyl]phenyl]hexan-1-one |
|---|---|
| PubChem CID | 158901765 |
| Molecular Formula | C37H46N6O2 |
| Molecular Weight | 606.82 g/mol |
| Exact Mass | 606.37 |
| IUPAC Name | 5-methyl-5-(methylamino)-1-[4-[[13-[4-methyl-4-(methylamino)pentanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl]methyl]phenyl]hexan-1-one |
| SMILES | CNC(C)(C)CCCC(=O)c1ccc(Cn2nnc3c2-c2ccccc2CN(C(=O)CCC(C)(C)NC)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C37H46N6O2/c1-36(2,38-5)22-11-16-32(44)27-19-17-26(18-20-27)24-43-35-29-13-8-7-12-28(29)25-42(33(45)21-23-37(3,4)39-6)31-15-10-9-14-30(31)34(35)40-41-43/h7-10,12-15,17-20,38-39H,11,16,21-25H2,1-6H3 |
| InChIKey | VFOWORZPAHHWCB-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.82 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |