About methane;2-methylpropane;1,3-thiazole
methane;2-methylpropane;1,3-thiazole (PubChem CID 158903774) has the molecular formula C8H17NS
and a molecular weight of 159.30 g/mol. Its IUPAC name is methane;2-methylpropane;1,3-thiazole.
Molecular Properties
| Compound Name | methane;2-methylpropane;1,3-thiazole |
| PubChem CID | 158903774 |
| Molecular Formula | C8H17NS |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | methane;2-methylpropane;1,3-thiazole |
| SMILES | C.CC(C)C.c1cscn1 |
| InChI | InChI=1S/C4H10.C3H3NS.CH4/c1-4(2)3;1-2-5-3-4-1;/h4H,1-3H3;1-3H;1H4 |
| InChIKey | JFTVXGIVHTUPMO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;2-methylpropane;1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylpropane;1,3-thiazole?
The IUPAC name of methane;2-methylpropane;1,3-thiazole (CID 158903774) is methane;2-methylpropane;1,3-thiazole.
What is the SMILES notation for methane;2-methylpropane;1,3-thiazole?
The canonical SMILES for methane;2-methylpropane;1,3-thiazole is C.CC(C)C.c1cscn1.
What is the InChIKey of methane;2-methylpropane;1,3-thiazole?
The InChIKey is JFTVXGIVHTUPMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C3H3NS.CH4/c1-4(2)3;1-2-5-3-4-1;/h4H,1-3H3;1-3H;1H4.
What are the key properties of methane;2-methylpropane;1,3-thiazole?
methane;2-methylpropane;1,3-thiazole has a molecular weight of 159.30 g/mol, XLogP of 3.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylpropane;1,3-thiazole is sourced from PubChem (CID 158903774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).