About ethane;2-methylpropane;1,3-thiazole
ethane;2-methylpropane;1,3-thiazole (PubChem CID 90889940) has the molecular formula C9H19NS
and a molecular weight of 173.33 g/mol. Its IUPAC name is ethane;2-methylpropane;1,3-thiazole.
Molecular Properties
| Compound Name | ethane;2-methylpropane;1,3-thiazole |
| PubChem CID | 90889940 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.33 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | ethane;2-methylpropane;1,3-thiazole |
| SMILES | CC.CC(C)C.c1cscn1 |
| InChI | InChI=1S/C4H10.C3H3NS.C2H6/c1-4(2)3;1-2-5-3-4-1;1-2/h4H,1-3H3;1-3H;1-2H3 |
| InChIKey | WKTVLPHPIJRPHY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methylpropane;1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropane;1,3-thiazole?
The IUPAC name of ethane;2-methylpropane;1,3-thiazole (CID 90889940) is ethane;2-methylpropane;1,3-thiazole.
What is the SMILES notation for ethane;2-methylpropane;1,3-thiazole?
The canonical SMILES for ethane;2-methylpropane;1,3-thiazole is CC.CC(C)C.c1cscn1.
What is the InChIKey of ethane;2-methylpropane;1,3-thiazole?
The InChIKey is WKTVLPHPIJRPHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C3H3NS.C2H6/c1-4(2)3;1-2-5-3-4-1;1-2/h4H,1-3H3;1-3H;1-2H3.
What are the key properties of ethane;2-methylpropane;1,3-thiazole?
ethane;2-methylpropane;1,3-thiazole has a molecular weight of 173.33 g/mol, XLogP of 3.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropane;1,3-thiazole is sourced from PubChem (CID 90889940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).