C25H25NO4 — CID 158904444
1-(9H-carbazol-2-yloxy)-4-(hydroxymethyl)-5-(2-methylphenoxy)pentan-2-one (PubChem CID 158904444) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-(9H-carbazol-2-yloxy)-4-(hydroxymethyl)-5-(2-methylphenoxy)pentan-2-one.
| Compound Name | 1-(9H-carbazol-2-yloxy)-4-(hydroxymethyl)-5-(2-methylphenoxy)pentan-2-one |
|---|---|
| PubChem CID | 158904444 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-(9H-carbazol-2-yloxy)-4-(hydroxymethyl)-5-(2-methylphenoxy)pentan-2-one |
| SMILES | Cc1ccccc1OCC(CO)CC(=O)COc1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C25H25NO4/c1-17-6-2-5-9-25(17)30-15-18(14-27)12-19(28)16-29-20-10-11-22-21-7-3-4-8-23(21)26-24(22)13-20/h2-11,13,18,26-27H,12,14-16H2,1H3 |
| InChIKey | JFWDHKVOYVAYJJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |