About N-benzylhydroxylamine;dibutyl hydrogen phosphate
N-benzylhydroxylamine;dibutyl hydrogen phosphate (PubChem CID 158905172) has the molecular formula C15H28NO5P
and a molecular weight of 333.36 g/mol. Its IUPAC name is N-benzylhydroxylamine;dibutyl hydrogen phosphate.
Molecular Properties
| Compound Name | N-benzylhydroxylamine;dibutyl hydrogen phosphate |
| PubChem CID | 158905172 |
| Molecular Formula | C15H28NO5P |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-benzylhydroxylamine;dibutyl hydrogen phosphate |
| SMILES | CCCCOP(=O)(O)OCCCC.ONCc1ccccc1 |
| InChI | InChI=1S/C8H19O4P.C7H9NO/c1-3-5-7-11-13(9,10)12-8-6-4-2;9-8-6-7-4-2-1-3-5-7/h3-8H2,1-2H3,(H,9,10);1-5,8-9H,6H2 |
| InChIKey | JFYLAOYHKYMSHB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-benzylhydroxylamine;dibutyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylhydroxylamine;dibutyl hydrogen phosphate?
The IUPAC name of N-benzylhydroxylamine;dibutyl hydrogen phosphate (CID 158905172) is N-benzylhydroxylamine;dibutyl hydrogen phosphate.
What is the SMILES notation for N-benzylhydroxylamine;dibutyl hydrogen phosphate?
The canonical SMILES for N-benzylhydroxylamine;dibutyl hydrogen phosphate is CCCCOP(=O)(O)OCCCC.ONCc1ccccc1.
What is the InChIKey of N-benzylhydroxylamine;dibutyl hydrogen phosphate?
The InChIKey is JFYLAOYHKYMSHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19O4P.C7H9NO/c1-3-5-7-11-13(9,10)12-8-6-4-2;9-8-6-7-4-2-1-3-5-7/h3-8H2,1-2H3,(H,9,10);1-5,8-9H,6H2.
What are the key properties of N-benzylhydroxylamine;dibutyl hydrogen phosphate?
N-benzylhydroxylamine;dibutyl hydrogen phosphate has a molecular weight of 333.36 g/mol, XLogP of 3.89, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylhydroxylamine;dibutyl hydrogen phosphate is sourced from PubChem (CID 158905172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).