C5H13Cl7N4O2P4 — CID 158906223
chloro-(2-methoxyethoxy)-methyl-methylimino-λ5-phosphane;2,2,4,4,6,6-hexachloro-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene (PubChem CID 158906223) has the molecular formula C5H13Cl7N4O2P4 and a molecular weight of 533.25 g/mol. Its IUPAC name is chloro-(2-methoxyethoxy)-methyl-methylimino-λ5-phosphane;2,2,4,4,6,6-hexachloro-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene.
| Compound Name | chloro-(2-methoxyethoxy)-methyl-methylimino-λ5-phosphane;2,2,4,4,6,6-hexachloro-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 158906223 |
| Molecular Formula | C5H13Cl7N4O2P4 |
| Molecular Weight | 533.25 g/mol |
| Exact Mass | 529.78 |
| IUPAC Name | chloro-(2-methoxyethoxy)-methyl-methylimino-λ5-phosphane;2,2,4,4,6,6-hexachloro-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
| SMILES | CN=P(C)(Cl)OCCOC.ClP1(Cl)=NP(Cl)(Cl)=NP(Cl)(Cl)=N1 |
| InChI | InChI=1S/C5H13ClNO2P.Cl6N3P3/c1-7-10(3,6)9-5-4-8-2;1-10(2)7-11(3,4)9-12(5,6)8-10/h4-5H2,1-3H3; |
| InChIKey | JGBQUJRSDZPPDZ-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.25 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|