About (2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone
(2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone (PubChem CID 158910738) has the molecular formula C38H30BBrO4
and a molecular weight of 641.37 g/mol. Its IUPAC name is (2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone.
Molecular Properties
| Compound Name | (2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone |
| PubChem CID | 158910738 |
| Molecular Formula | C38H30BBrO4 |
| Molecular Weight | 641.37 g/mol |
| Exact Mass | 640.14 |
| IUPAC Name | (2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone |
| SMILES | O=C(c1ccccc1)c1ccccc1-c1ccccc1.O=C(c1ccccc1)c1ccccc1Br.OB(O)c1ccccc1 |
| InChI | InChI=1S/C19H14O.C13H9BrO.C6H7BO2/c20-19(16-11-5-2-6-12-16)18-14-8-7-13-17(18)15-9-3-1-4-10-15;14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10;8-7(9)6-4-2-1-3-5-6/h1-14H;1-9H;1-5,8-9H |
| InChIKey | JGPNENGGPKJGCG-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 641.37 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone?
The IUPAC name of (2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone (CID 158910738) is (2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone.
What is the SMILES notation for (2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone?
The canonical SMILES for (2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone is O=C(c1ccccc1)c1ccccc1-c1ccccc1.O=C(c1ccccc1)c1ccccc1Br.OB(O)c1ccccc1.
What is the InChIKey of (2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone?
The InChIKey is JGPNENGGPKJGCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O.C13H9BrO.C6H7BO2/c20-19(16-11-5-2-6-12-16)18-14-8-7-13-17(18)15-9-3-1-4-10-15;14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10;8-7(9)6-4-2-1-3-5-6/h1-14H;1-9H;1-5,8-9H.
What are the key properties of (2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone?
(2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone has a molecular weight of 641.37 g/mol, XLogP of 7.63, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)-phenylmethanone;phenylboronic acid;phenyl-(2-phenylphenyl)methanone is sourced from PubChem (CID 158910738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).