C36H22Br2O2 — CID 166012594
[2-[5-(2-benzoylphenyl)-4,8-dibromonaphthalen-1-yl]phenyl]-phenylmethanone (PubChem CID 166012594) has the molecular formula C36H22Br2O2 and a molecular weight of 646.38 g/mol. Its IUPAC name is [2-[5-(2-benzoylphenyl)-4,8-dibromonaphthalen-1-yl]phenyl]-phenylmethanone.
| Compound Name | [2-[5-(2-benzoylphenyl)-4,8-dibromonaphthalen-1-yl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 166012594 |
| Molecular Formula | C36H22Br2O2 |
| Molecular Weight | 646.38 g/mol |
| Exact Mass | 644.00 |
| IUPAC Name | [2-[5-(2-benzoylphenyl)-4,8-dibromonaphthalen-1-yl]phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccccc1-c1ccc(Br)c2c(-c3ccccc3C(=O)c3ccccc3)ccc(Br)c12 |
| InChI | InChI=1S/C36H22Br2O2/c37-31-22-20-28(26-16-8-10-18-30(26)36(40)24-13-5-2-6-14-24)34-32(38)21-19-27(33(31)34)25-15-7-9-17-29(25)35(39)23-11-3-1-4-12-23/h1-22H |
| InChIKey | CJVGJSBINIDIPT-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.38 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |