C40H45Cl2N5O5 — CID 158912483
benzyl 6-chlorospiro[1,2-dihydroindole-3,4'-piperidine]-1'-carboxylate;benzyl 4-formylpiperidine-1-carboxylate;(3-chlorophenyl)hydrazine (PubChem CID 158912483) has the molecular formula C40H45Cl2N5O5 and a molecular weight of 746.74 g/mol. Its IUPAC name is benzyl 6-chlorospiro[1,2-dihydroindole-3,4'-piperidine]-1'-carboxylate;benzyl 4-formylpiperidine-1-carboxylate;(3-chlorophenyl)hydrazine.
| Compound Name | benzyl 6-chlorospiro[1,2-dihydroindole-3,4'-piperidine]-1'-carboxylate;benzyl 4-formylpiperidine-1-carboxylate;(3-chlorophenyl)hydrazine |
|---|---|
| PubChem CID | 158912483 |
| Molecular Formula | C40H45Cl2N5O5 |
| Molecular Weight | 746.74 g/mol |
| Exact Mass | 745.28 |
| IUPAC Name | benzyl 6-chlorospiro[1,2-dihydroindole-3,4'-piperidine]-1'-carboxylate;benzyl 4-formylpiperidine-1-carboxylate;(3-chlorophenyl)hydrazine |
| SMILES | NNc1cccc(Cl)c1.O=C(OCc1ccccc1)N1CCC2(CC1)CNc1cc(Cl)ccc12.O=CC1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H21ClN2O2.C14H17NO3.C6H7ClN2/c21-16-6-7-17-18(12-16)22-14-20(17)8-10-23(11-9-20)19(24)25-13-15-4-2-1-3-5-15;16-10-12-6-8-15(9-7-12)14(17)18-11-13-4-2-1-3-5-13;7-5-2-1-3-6(4-5)9-8/h1-7,12,22H,8-11,13-14H2;1-5,10,12H,6-9,11H2;1-4,9H,8H2 |
| InChIKey | JGVBISLZZWCSJI-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.74 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|