C21H21Cl2FN2O3 — CID 164862844
benzyl 4-[(2-chloroacetyl)amino]-4-(4-chloro-2-fluorophenyl)piperidine-1-carboxylate (PubChem CID 164862844) has the molecular formula C21H21Cl2FN2O3 and a molecular weight of 439.31 g/mol. Its IUPAC name is benzyl 4-[(2-chloroacetyl)amino]-4-(4-chloro-2-fluorophenyl)piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(2-chloroacetyl)amino]-4-(4-chloro-2-fluorophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164862844 |
| Molecular Formula | C21H21Cl2FN2O3 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | benzyl 4-[(2-chloroacetyl)amino]-4-(4-chloro-2-fluorophenyl)piperidine-1-carboxylate |
| SMILES | O=C(CCl)NC1(c2ccc(Cl)cc2F)CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H21Cl2FN2O3/c22-13-19(27)25-21(17-7-6-16(23)12-18(17)24)8-10-26(11-9-21)20(28)29-14-15-4-2-1-3-5-15/h1-7,12H,8-11,13-14H2,(H,25,27) |
| InChIKey | DSBWHGKJADNQBZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|