C42H38Cl2O10 — CID 158913009
acetyl acetate;4-(4-chloro-2,6-dimethylphenyl)-3-hydroxy-2-phenyl-2H-furan-5-one;[4-(4-chloro-2,6-dimethylphenyl)-5-oxo-2-phenyl-2H-furan-3-yl] acetate (PubChem CID 158913009) has the molecular formula C42H38Cl2O10 and a molecular weight of 773.66 g/mol. Its IUPAC name is acetyl acetate;4-(4-chloro-2,6-dimethylphenyl)-3-hydroxy-2-phenyl-2H-furan-5-one;[4-(4-chloro-2,6-dimethylphenyl)-5-oxo-2-phenyl-2H-furan-3-yl] acetate.
| Compound Name | acetyl acetate;4-(4-chloro-2,6-dimethylphenyl)-3-hydroxy-2-phenyl-2H-furan-5-one;[4-(4-chloro-2,6-dimethylphenyl)-5-oxo-2-phenyl-2H-furan-3-yl] acetate |
|---|---|
| PubChem CID | 158913009 |
| Molecular Formula | C42H38Cl2O10 |
| Molecular Weight | 773.66 g/mol |
| Exact Mass | 772.18 |
| IUPAC Name | acetyl acetate;4-(4-chloro-2,6-dimethylphenyl)-3-hydroxy-2-phenyl-2H-furan-5-one;[4-(4-chloro-2,6-dimethylphenyl)-5-oxo-2-phenyl-2H-furan-3-yl] acetate |
| SMILES | CC(=O)OC(C)=O.CC(=O)OC1=C(c2c(C)cc(Cl)cc2C)C(=O)OC1c1ccccc1.Cc1cc(Cl)cc(C)c1C1=C(O)C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C20H17ClO4.C18H15ClO3.C4H6O3/c1-11-9-15(21)10-12(2)16(11)17-19(24-13(3)22)18(25-20(17)23)14-7-5-4-6-8-14;1-10-8-13(19)9-11(2)14(10)15-16(20)17(22-18(15)21)12-6-4-3-5-7-12;1-3(5)7-4(2)6/h4-10,18H,1-3H3;3-9,17,20H,1-2H3;1-2H3 |
| InChIKey | JGWPIKYYQSHBHK-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.66 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|