C17H14O5 — CID 86015386
(6-hydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-5-yl) acetate (PubChem CID 86015386) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is (6-hydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-5-yl) acetate.
| Compound Name | (6-hydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-5-yl) acetate |
|---|---|
| PubChem CID | 86015386 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (6-hydroxy-4-oxo-2-phenyl-2,3-dihydrochromen-5-yl) acetate |
| SMILES | CC(=O)Oc1c(O)ccc2c1C(=O)CC(c1ccccc1)O2 |
| InChI | InChI=1S/C17H14O5/c1-10(18)21-17-12(19)7-8-14-16(17)13(20)9-15(22-14)11-5-3-2-4-6-11/h2-8,15,19H,9H2,1H3 |
| InChIKey | OJVBWYRLTRVFBC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|