About (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one
(2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 102167618) has the molecular formula C15H12O5
and a molecular weight of 272.26 g/mol. Its IUPAC name is (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| PubChem CID | 102167618 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1C[C@@H](c2ccccc2O)Oc2ccc(O)c(O)c21 |
| InChI | InChI=1S/C15H12O5/c16-9-4-2-1-3-8(9)13-7-11(18)14-12(20-13)6-5-10(17)15(14)19/h1-6,13,16-17,19H,7H2/t13-/m0/s1 |
| InChIKey | YMTBJXKTNRXNQX-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one?
The IUPAC name of (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one (CID 102167618) is (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one.
What is the SMILES notation for (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one?
The canonical SMILES for (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one is O=C1C[C@@H](c2ccccc2O)Oc2ccc(O)c(O)c21.
What is the InChIKey of (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one?
The InChIKey is YMTBJXKTNRXNQX-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H12O5/c16-9-4-2-1-3-8(9)13-7-11(18)14-12(20-13)6-5-10(17)15(14)19/h1-6,13,16-17,19H,7H2/t13-/m0/s1.
What are the key properties of (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one?
(2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one has a molecular weight of 272.26 g/mol, XLogP of 2.51, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one is sourced from PubChem (CID 102167618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).