C15H12O5 — CID 102167618
(2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 102167618) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 102167618 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (2S)-5,6-dihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1C[C@@H](c2ccccc2O)Oc2ccc(O)c(O)c21 |
| InChI | InChI=1S/C15H12O5/c16-9-4-2-1-3-8(9)13-7-11(18)14-12(20-13)6-5-10(17)15(14)19/h1-6,13,16-17,19H,7H2/t13-/m0/s1 |
| InChIKey | YMTBJXKTNRXNQX-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|