C19H16O7 — CID 122206932
[5-acetyloxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-7-yl] acetate (PubChem CID 122206932) has the molecular formula C19H16O7 and a molecular weight of 356.33 g/mol. Its IUPAC name is [5-acetyloxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-7-yl] acetate.
| Compound Name | [5-acetyloxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-7-yl] acetate |
|---|---|
| PubChem CID | 122206932 |
| Molecular Formula | C19H16O7 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [5-acetyloxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-7-yl] acetate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)c2c(c1)OC(c1ccc(O)cc1)CC2=O |
| InChI | InChI=1S/C19H16O7/c1-10(20)24-14-7-17(25-11(2)21)19-15(23)9-16(26-18(19)8-14)12-3-5-13(22)6-4-12/h3-8,16,22H,9H2,1-2H3 |
| InChIKey | YPXUTJIUFUIZOS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|