C27H23NO8 — CID 139296586
[5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-7-yl] 2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propanoate (PubChem CID 139296586) has the molecular formula C27H23NO8 and a molecular weight of 489.48 g/mol. Its IUPAC name is [5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-7-yl] 2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propanoate.
| Compound Name | [5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-7-yl] 2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 139296586 |
| Molecular Formula | C27H23NO8 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-7-yl] 2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propanoate |
| SMILES | CC(NC(=O)/C=C/c1ccc(O)cc1)C(=O)Oc1cc(O)c2c(c1)OC(c1ccc(O)cc1)CC2=O |
| InChI | InChI=1S/C27H23NO8/c1-15(28-25(33)11-4-16-2-7-18(29)8-3-16)27(34)35-20-12-21(31)26-22(32)14-23(36-24(26)13-20)17-5-9-19(30)10-6-17/h2-13,15,23,29-31H,14H2,1H3,(H,28,33)/b11-4+ |
| InChIKey | FEGOMCPEIFDQJU-NYYWCZLTSA-N |
| XLogP | 3.63 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|