C31H30N2O5S — CID 158915833
1-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-[3-[4-(4-imidazol-1-ylbutylsulfonyl)phenyl]phenyl]ethanone (PubChem CID 158915833) has the molecular formula C31H30N2O5S and a molecular weight of 542.66 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-[3-[4-(4-imidazol-1-ylbutylsulfonyl)phenyl]phenyl]ethanone.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-[3-[4-(4-imidazol-1-ylbutylsulfonyl)phenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 158915833 |
| Molecular Formula | C31H30N2O5S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)cyclopropyl]-2-[3-[4-(4-imidazol-1-ylbutylsulfonyl)phenyl]phenyl]ethanone |
| SMILES | O=C(Cc1cccc(-c2ccc(S(=O)(=O)CCCCn3ccnc3)cc2)c1)C1(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C31H30N2O5S/c34-30(31(12-13-31)26-8-11-28-29(20-26)38-22-37-28)19-23-4-3-5-25(18-23)24-6-9-27(10-7-24)39(35,36)17-2-1-15-33-16-14-32-21-33/h3-11,14,16,18,20-21H,1-2,12-13,15,17,19,22H2 |
| InChIKey | JHFHHJOVTWYZSJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|