C28H27N5O5S — CID 59165919
1-(1,3-benzodioxol-5-yl)-N-[6-[4-(3-imidazol-1-ylpropylsulfamoyl)phenyl]-2-pyridinyl]cyclopropane-1-carboxamide (PubChem CID 59165919) has the molecular formula C28H27N5O5S and a molecular weight of 545.62 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[6-[4-(3-imidazol-1-ylpropylsulfamoyl)phenyl]-2-pyridinyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[6-[4-(3-imidazol-1-ylpropylsulfamoyl)phenyl]-2-pyridinyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59165919 |
| Molecular Formula | C28H27N5O5S |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[6-[4-(3-imidazol-1-ylpropylsulfamoyl)phenyl]-2-pyridinyl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ccc(S(=O)(=O)NCCCn3ccnc3)cc2)n1)C1(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C28H27N5O5S/c34-27(28(11-12-28)21-7-10-24-25(17-21)38-19-37-24)32-26-4-1-3-23(31-26)20-5-8-22(9-6-20)39(35,36)30-13-2-15-33-16-14-29-18-33/h1,3-10,14,16-18,30H,2,11-13,15,19H2,(H,31,32,34) |
| InChIKey | DVYSGIIOCCOFFK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|