C27H29N3O7S — CID 163876937
(2R)-N-[4-[6-[[1-(1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-2-pyridinyl]phenyl]sulfonyl-1-hydroxypentan-2-amine oxide (PubChem CID 163876937) has the molecular formula C27H29N3O7S and a molecular weight of 539.61 g/mol. Its IUPAC name is (2R)-N-[4-[6-[[1-(1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-2-pyridinyl]phenyl]sulfonyl-1-hydroxypentan-2-amine oxide.
| Compound Name | (2R)-N-[4-[6-[[1-(1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-2-pyridinyl]phenyl]sulfonyl-1-hydroxypentan-2-amine oxide |
|---|---|
| PubChem CID | 163876937 |
| Molecular Formula | C27H29N3O7S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | (2R)-N-[4-[6-[[1-(1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-2-pyridinyl]phenyl]sulfonyl-1-hydroxypentan-2-amine oxide |
| SMILES | CCC[C@H](CO)[NH+]([O-])S(=O)(=O)c1ccc(-c2cccc(NC(=O)C3(c4ccc5c(c4)OCO5)CC3)n2)cc1 |
| InChI | InChI=1S/C27H29N3O7S/c1-2-4-20(16-31)30(33)38(34,35)21-10-7-18(8-11-21)22-5-3-6-25(28-22)29-26(32)27(13-14-27)19-9-12-23-24(15-19)37-17-36-23/h3,5-12,15,20,30-31H,2,4,13-14,16-17H2,1H3,(H,28,29,32)/t20-/m1/s1 |
| InChIKey | PPRXZIDPKLBXDV-HXUWFJFHSA-N |
| XLogP | 2.38 |
| TPSA | 142.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|