C24H22N2O4S — CID 67120691
1-(1,3-benzodioxol-5-yl)-N-[6-[4-(methoxymethylsulfanyl)phenyl]-2-pyridinyl]cyclopropane-1-carboxamide (PubChem CID 67120691) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[6-[4-(methoxymethylsulfanyl)phenyl]-2-pyridinyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[6-[4-(methoxymethylsulfanyl)phenyl]-2-pyridinyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 67120691 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[6-[4-(methoxymethylsulfanyl)phenyl]-2-pyridinyl]cyclopropane-1-carboxamide |
| SMILES | COCSc1ccc(-c2cccc(NC(=O)C3(c4ccc5c(c4)OCO5)CC3)n2)cc1 |
| InChI | InChI=1S/C24H22N2O4S/c1-28-15-31-18-8-5-16(6-9-18)19-3-2-4-22(25-19)26-23(27)24(11-12-24)17-7-10-20-21(13-17)30-14-29-20/h2-10,13H,11-12,14-15H2,1H3,(H,25,26,27) |
| InChIKey | IMUBUPGVYMCHDW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|