C25H23F2N9O4 — CID 158920290
1-(2-fluoroethyl)indazol-5-amine;1-(2-fluoroethyl)-5-nitroindazole;5-nitro-1H-indazole (PubChem CID 158920290) has the molecular formula C25H23F2N9O4 and a molecular weight of 551.51 g/mol. Its IUPAC name is 1-(2-fluoroethyl)indazol-5-amine;1-(2-fluoroethyl)-5-nitroindazole;5-nitro-1H-indazole.
| Compound Name | 1-(2-fluoroethyl)indazol-5-amine;1-(2-fluoroethyl)-5-nitroindazole;5-nitro-1H-indazole |
|---|---|
| PubChem CID | 158920290 |
| Molecular Formula | C25H23F2N9O4 |
| Molecular Weight | 551.51 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 1-(2-fluoroethyl)indazol-5-amine;1-(2-fluoroethyl)-5-nitroindazole;5-nitro-1H-indazole |
| SMILES | Nc1ccc2c(cnn2CCF)c1.O=[N+]([O-])c1ccc2[nH]ncc2c1.O=[N+]([O-])c1ccc2c(cnn2CCF)c1 |
| InChI | InChI=1S/C9H8FN3O2.C9H10FN3.C7H5N3O2/c10-3-4-12-9-2-1-8(13(14)15)5-7(9)6-11-12;10-3-4-13-9-2-1-8(11)5-7(9)6-12-13;11-10(12)6-1-2-7-5(3-6)4-8-9-7/h1-2,5-6H,3-4H2;1-2,5-6H,3-4,11H2;1-4H,(H,8,9) |
| InChIKey | JHTFXVKQQQHXQI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 176.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|