C15H13Br2O6S2Zr — CID 158920612
2,7-dibromo-9H-fluoren-9-ide;methanesulfonate;zirconium(3+) (PubChem CID 158920612) has the molecular formula C15H13Br2O6S2Zr and a molecular weight of 604.43 g/mol. Its IUPAC name is 2,7-dibromo-9H-fluoren-9-ide;methanesulfonate;zirconium(3+).
| Compound Name | 2,7-dibromo-9H-fluoren-9-ide;methanesulfonate;zirconium(3+) |
|---|---|
| PubChem CID | 158920612 |
| Molecular Formula | C15H13Br2O6S2Zr |
| Molecular Weight | 604.43 g/mol |
| Exact Mass | 600.76 |
| IUPAC Name | 2,7-dibromo-9H-fluoren-9-ide;methanesulfonate;zirconium(3+) |
| SMILES | Brc1ccc2c(c1)[cH-]c1cc(Br)ccc12.CS(=O)(=O)[O-].CS(=O)(=O)[O-].[Zr+3] |
| InChI | InChI=1S/C13H7Br2.2CH4O3S.Zr/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12;2*1-5(2,3)4;/h1-7H;2*1H3,(H,2,3,4);/q-1;;;+3/p-2 |
| InChIKey | MMDHVWPDVIIDSE-UHFFFAOYSA-L |
| XLogP | 3.56 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|