C21H20Cl3N — CID 158920701
2-[6-(2,3,5-trichlorophenyl)hexyl]quinoline (PubChem CID 158920701) has the molecular formula C21H20Cl3N and a molecular weight of 392.76 g/mol. Its IUPAC name is 2-[6-(2,3,5-trichlorophenyl)hexyl]quinoline.
| Compound Name | 2-[6-(2,3,5-trichlorophenyl)hexyl]quinoline |
|---|---|
| PubChem CID | 158920701 |
| Molecular Formula | C21H20Cl3N |
| Molecular Weight | 392.76 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-[6-(2,3,5-trichlorophenyl)hexyl]quinoline |
| SMILES | Clc1cc(Cl)c(Cl)c(CCCCCCc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C21H20Cl3N/c22-17-13-16(21(24)19(23)14-17)8-3-1-2-4-9-18-12-11-15-7-5-6-10-20(15)25-18/h5-7,10-14H,1-4,8-9H2 |
| InChIKey | IRKWATXUPDRETR-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.76 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|