C24H14Cl3N3O — CID 58156130
2-quinolin-2-yl-1-[2-(2,4,6-trichlorophenyl)-3H-benzimidazol-5-yl]ethanone (PubChem CID 58156130) has the molecular formula C24H14Cl3N3O and a molecular weight of 466.76 g/mol. Its IUPAC name is 2-quinolin-2-yl-1-[2-(2,4,6-trichlorophenyl)-3H-benzimidazol-5-yl]ethanone.
| Compound Name | 2-quinolin-2-yl-1-[2-(2,4,6-trichlorophenyl)-3H-benzimidazol-5-yl]ethanone |
|---|---|
| PubChem CID | 58156130 |
| Molecular Formula | C24H14Cl3N3O |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | 2-quinolin-2-yl-1-[2-(2,4,6-trichlorophenyl)-3H-benzimidazol-5-yl]ethanone |
| SMILES | O=C(Cc1ccc2ccccc2n1)c1ccc2nc(-c3c(Cl)cc(Cl)cc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C24H14Cl3N3O/c25-15-10-17(26)23(18(27)11-15)24-29-20-8-6-14(9-21(20)30-24)22(31)12-16-7-5-13-3-1-2-4-19(13)28-16/h1-11H,12H2,(H,29,30) |
| InChIKey | VZYKLQBPBVCSCW-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |