C24H15Cl2N3O — CID 58156343
1-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-2-quinolin-6-ylethanone (PubChem CID 58156343) has the molecular formula C24H15Cl2N3O and a molecular weight of 432.31 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-2-quinolin-6-ylethanone.
| Compound Name | 1-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-2-quinolin-6-ylethanone |
|---|---|
| PubChem CID | 58156343 |
| Molecular Formula | C24H15Cl2N3O |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 1-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-2-quinolin-6-ylethanone |
| SMILES | O=C(Cc1ccc2ncccc2c1)c1ccc2nc(-c3c(Cl)cccc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C24H15Cl2N3O/c25-17-4-1-5-18(26)23(17)24-28-20-9-7-16(13-21(20)29-24)22(30)12-14-6-8-19-15(11-14)3-2-10-27-19/h1-11,13H,12H2,(H,28,29) |
| InChIKey | OXZHQAILAROYKC-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |