C25H16Cl2N2O3 — CID 58156249
7-[2-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-2-oxoethyl]-4-methylchromen-2-one (PubChem CID 58156249) has the molecular formula C25H16Cl2N2O3 and a molecular weight of 463.32 g/mol. Its IUPAC name is 7-[2-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-2-oxoethyl]-4-methylchromen-2-one.
| Compound Name | 7-[2-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-2-oxoethyl]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 58156249 |
| Molecular Formula | C25H16Cl2N2O3 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 7-[2-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-2-oxoethyl]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(CC(=O)c3ccc4nc(-c5c(Cl)cccc5Cl)[nH]c4c3)ccc12 |
| InChI | InChI=1S/C25H16Cl2N2O3/c1-13-9-23(31)32-22-11-14(5-7-16(13)22)10-21(30)15-6-8-19-20(12-15)29-25(28-19)24-17(26)3-2-4-18(24)27/h2-9,11-12H,10H2,1H3,(H,28,29) |
| InChIKey | CSUXTKIOYRLBKE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|