C26H20Cl2N2O3 — CID 58156253
ethyl (E)-3-[4-[2-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-2-oxoethyl]phenyl]prop-2-enoate (PubChem CID 58156253) has the molecular formula C26H20Cl2N2O3 and a molecular weight of 479.36 g/mol. Its IUPAC name is ethyl (E)-3-[4-[2-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-2-oxoethyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[2-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-2-oxoethyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58156253 |
| Molecular Formula | C26H20Cl2N2O3 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | ethyl (E)-3-[4-[2-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-2-oxoethyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(CC(=O)c2ccc3nc(-c4c(Cl)cccc4Cl)[nH]c3c2)cc1 |
| InChI | InChI=1S/C26H20Cl2N2O3/c1-2-33-24(32)13-10-16-6-8-17(9-7-16)14-23(31)18-11-12-21-22(15-18)30-26(29-21)25-19(27)4-3-5-20(25)28/h3-13,15H,2,14H2,1H3,(H,29,30)/b13-10+ |
| InChIKey | WCKLWFHXRCZFEA-JLHYYAGUSA-N |
| XLogP | 6.54 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|