C40H44SiZr — CID 158920886
bis(2,7-dimethyl-4-(2-phenylethyl)-1H-inden-1-ide);dimethylsilylidenezirconium(2+) (PubChem CID 158920886) has the molecular formula C40H44SiZr and a molecular weight of 644.10 g/mol. Its IUPAC name is bis(2,7-dimethyl-4-(2-phenylethyl)-1H-inden-1-ide);dimethylsilylidenezirconium(2+).
| Compound Name | bis(2,7-dimethyl-4-(2-phenylethyl)-1H-inden-1-ide);dimethylsilylidenezirconium(2+) |
|---|---|
| PubChem CID | 158920886 |
| Molecular Formula | C40H44SiZr |
| Molecular Weight | 644.10 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | bis(2,7-dimethyl-4-(2-phenylethyl)-1H-inden-1-ide);dimethylsilylidenezirconium(2+) |
| SMILES | C[Si](C)=[Zr+2].Cc1cc2c(CCc3ccccc3)ccc(C)c2[cH-]1.Cc1cc2c(CCc3ccccc3)ccc(C)c2[cH-]1 |
| InChI | InChI=1S/2C19H19.C2H6Si.Zr/c2*1-14-12-18-15(2)8-10-17(19(18)13-14)11-9-16-6-4-3-5-7-16;1-3-2;/h2*3-8,10,12-13H,9,11H2,1-2H3;1-2H3;/q2*-1;;+2 |
| InChIKey | QLZAPMUPNHJZEJ-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.10 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|