C53H88N4O4 — CID 158921137
4-butoxy-N-[(4-butoxyphenyl)methyl]-N-[2-(dibutylamino)ethyl]benzamide;N-[(4-butoxyphenyl)methyl]-N',N'-dibutylethane-1,2-diamine (PubChem CID 158921137) has the molecular formula C53H88N4O4 and a molecular weight of 845.31 g/mol. Its IUPAC name is 4-butoxy-N-[(4-butoxyphenyl)methyl]-N-[2-(dibutylamino)ethyl]benzamide;N-[(4-butoxyphenyl)methyl]-N',N'-dibutylethane-1,2-diamine.
| Compound Name | 4-butoxy-N-[(4-butoxyphenyl)methyl]-N-[2-(dibutylamino)ethyl]benzamide;N-[(4-butoxyphenyl)methyl]-N',N'-dibutylethane-1,2-diamine |
|---|---|
| PubChem CID | 158921137 |
| Molecular Formula | C53H88N4O4 |
| Molecular Weight | 845.31 g/mol |
| Exact Mass | 844.68 |
| IUPAC Name | 4-butoxy-N-[(4-butoxyphenyl)methyl]-N-[2-(dibutylamino)ethyl]benzamide;N-[(4-butoxyphenyl)methyl]-N',N'-dibutylethane-1,2-diamine |
| SMILES | CCCCOc1ccc(CN(CCN(CCCC)CCCC)C(=O)c2ccc(OCCCC)cc2)cc1.CCCCOc1ccc(CNCCN(CCCC)CCCC)cc1 |
| InChI | InChI=1S/C32H50N2O3.C21H38N2O/c1-5-9-21-33(22-10-6-2)23-24-34(27-28-13-17-30(18-14-28)36-25-11-7-3)32(35)29-15-19-31(20-16-29)37-26-12-8-4;1-4-7-15-23(16-8-5-2)17-14-22-19-20-10-12-21(13-11-20)24-18-9-6-3/h13-20H,5-12,21-27H2,1-4H3;10-13,22H,4-9,14-19H2,1-3H3 |
| InChIKey | JHVRFDZBVWUXBK-UHFFFAOYSA-N |
| XLogP | 12.45 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.31 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|